About 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine
2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine (PubChem CID 163804603) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine.
Molecular Properties
| Compound Name | 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine |
| PubChem CID | 163804603 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine |
| SMILES | CCC(C)(C)NC(C)(C)C(C)(C)N |
| InChI | InChI=1S/C11H26N2/c1-8-9(2,3)13-11(6,7)10(4,5)12/h13H,8,12H2,1-7H3 |
| InChIKey | NHYHNFWMTNPBPP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine?
The IUPAC name of 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine (CID 163804603) is 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine.
What is the SMILES notation for 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine?
The canonical SMILES for 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine is CCC(C)(C)NC(C)(C)C(C)(C)N.
What is the InChIKey of 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine?
The InChIKey is NHYHNFWMTNPBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2/c1-8-9(2,3)13-11(6,7)10(4,5)12/h13H,8,12H2,1-7H3.
What are the key properties of 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine?
2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine has a molecular weight of 186.34 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-3-N-(2-methylbutan-2-yl)butane-2,3-diamine is sourced from PubChem (CID 163804603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).