C26H30ClF4NO4S2 — CID 163804791
2,3,5,6-tetrafluoro-4-[4-[[4-(1-methylcycloheptyl)phenyl]methyl]piperidin-1-yl]sulfonylbenzenesulfonyl chloride (PubChem CID 163804791) has the molecular formula C26H30ClF4NO4S2 and a molecular weight of 596.11 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-[[4-(1-methylcycloheptyl)phenyl]methyl]piperidin-1-yl]sulfonylbenzenesulfonyl chloride.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-[[4-(1-methylcycloheptyl)phenyl]methyl]piperidin-1-yl]sulfonylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 163804791 |
| Molecular Formula | C26H30ClF4NO4S2 |
| Molecular Weight | 596.11 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-[[4-(1-methylcycloheptyl)phenyl]methyl]piperidin-1-yl]sulfonylbenzenesulfonyl chloride |
| SMILES | CC1(c2ccc(CC3CCN(S(=O)(=O)c4c(F)c(F)c(S(=O)(=O)Cl)c(F)c4F)CC3)cc2)CCCCCC1 |
| InChI | InChI=1S/C26H30ClF4NO4S2/c1-26(12-4-2-3-5-13-26)19-8-6-17(7-9-19)16-18-10-14-32(15-11-18)38(35,36)25-22(30)20(28)24(37(27,33)34)21(29)23(25)31/h6-9,18H,2-5,10-16H2,1H3 |
| InChIKey | NICNPDUCVPKXIN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.11 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|