About (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one
(5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one (PubChem CID 163805028) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one.
Molecular Properties
| Compound Name | (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one |
| PubChem CID | 163805028 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1NC2CSC[C@H](C2)N1 |
| InChI | InChI=1S/C6H10N2OS/c9-6-7-4-1-5(8-6)3-10-2-4/h4-5H,1-3H2,(H2,7,8,9)/t4-,5?/m0/s1 |
| InChIKey | NIHLBZGFUIMNDC-ROLXFIACSA-N |
| XLogP | 0.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one?
The IUPAC name of (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one (CID 163805028) is (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one is O=C1NC2CSC[C@H](C2)N1.
What is the InChIKey of (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one?
The InChIKey is NIHLBZGFUIMNDC-ROLXFIACSA-N. The full InChI is InChI=1S/C6H10N2OS/c9-6-7-4-1-5(8-6)3-10-2-4/h4-5H,1-3H2,(H2,7,8,9)/t4-,5?/m0/s1.
What are the key properties of (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one?
(5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one has a molecular weight of 158.23 g/mol, XLogP of 0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-thia-2,4-diazabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 163805028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).