About 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine
5-ethenyl-3,6-dimethyl-2H-1,4-thiazine (PubChem CID 163805346) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine |
| PubChem CID | 163805346 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine |
| SMILES | C=CC1=C(C)SCC(C)=N1 |
| InChI | InChI=1S/C8H11NS/c1-4-8-7(3)10-5-6(2)9-8/h4H,1,5H2,2-3H3 |
| InChIKey | NIOBLQFBMMQIQD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine?
The IUPAC name of 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine (CID 163805346) is 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine.
What is the SMILES notation for 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine?
The canonical SMILES for 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine is C=CC1=C(C)SCC(C)=N1.
What is the InChIKey of 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine?
The InChIKey is NIOBLQFBMMQIQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-4-8-7(3)10-5-6(2)9-8/h4H,1,5H2,2-3H3.
What are the key properties of 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine?
5-ethenyl-3,6-dimethyl-2H-1,4-thiazine has a molecular weight of 153.25 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3,6-dimethyl-2H-1,4-thiazine is sourced from PubChem (CID 163805346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).