C14H20N2 — CID 163805629
3-(2-methyl-2,3-dihydro-1H-inden-5-yl)diazinane (PubChem CID 163805629) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-(2-methyl-2,3-dihydro-1H-inden-5-yl)diazinane.
| Compound Name | 3-(2-methyl-2,3-dihydro-1H-inden-5-yl)diazinane |
|---|---|
| PubChem CID | 163805629 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-(2-methyl-2,3-dihydro-1H-inden-5-yl)diazinane |
| SMILES | CC1Cc2ccc(C3CCCNN3)cc2C1 |
| InChI | InChI=1S/C14H20N2/c1-10-7-11-4-5-12(9-13(11)8-10)14-3-2-6-15-16-14/h4-5,9-10,14-16H,2-3,6-8H2,1H3 |
| InChIKey | NIUHNEKCLKGSDB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |