C24H24N3O2S+ — CID 163806447
[2-[3-amino-2-(cyclopropylcarbamoyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-6-methylcyclohexa-2,4-dien-1-yl]oxidanium (PubChem CID 163806447) has the molecular formula C24H24N3O2S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is [2-[3-amino-2-(cyclopropylcarbamoyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-6-methylcyclohexa-2,4-dien-1-yl]oxidanium.
| Compound Name | [2-[3-amino-2-(cyclopropylcarbamoyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-6-methylcyclohexa-2,4-dien-1-yl]oxidanium |
|---|---|
| PubChem CID | 163806447 |
| Molecular Formula | C24H24N3O2S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-[3-amino-2-(cyclopropylcarbamoyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-6-methylcyclohexa-2,4-dien-1-yl]oxidanium |
| SMILES | CC1C=CC=C(c2cc(-c3ccccc3)c3c(N)c(C(=O)NC4CC4)sc3n2)C1[OH2+] |
| InChI | InChI=1S/C24H23N3O2S/c1-13-6-5-9-16(21(13)28)18-12-17(14-7-3-2-4-8-14)19-20(25)22(30-24(19)27-18)23(29)26-15-10-11-15/h2-9,12-13,15,21,28H,10-11,25H2,1H3,(H,26,29)/p+1 |
| InChIKey | NJLDMRDIMFZMOH-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|