C13H17NO — CID 163806481
3-methyl-1,2,4,5,7,8-hexahydrochromeno[3,4-c]pyridine (PubChem CID 163806481) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-methyl-1,2,4,5,7,8-hexahydrochromeno[3,4-c]pyridine.
| Compound Name | 3-methyl-1,2,4,5,7,8-hexahydrochromeno[3,4-c]pyridine |
|---|---|
| PubChem CID | 163806481 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-methyl-1,2,4,5,7,8-hexahydrochromeno[3,4-c]pyridine |
| SMILES | CN1CCC2=C(COC3=C2C=CCC3)C1 |
| InChI | InChI=1S/C13H17NO/c1-14-7-6-11-10(8-14)9-15-13-5-3-2-4-12(11)13/h2,4H,3,5-9H2,1H3 |
| InChIKey | NJMAQMRAZJDNLH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |