C40H31N5 — CID 163806487
5-[2-(3,4-diaminophenyl)-10-phenanthren-9-ylanthracen-9-yl]benzene-1,2,3-triamine (PubChem CID 163806487) has the molecular formula C40H31N5 and a molecular weight of 581.72 g/mol. Its IUPAC name is 5-[2-(3,4-diaminophenyl)-10-phenanthren-9-ylanthracen-9-yl]benzene-1,2,3-triamine.
| Compound Name | 5-[2-(3,4-diaminophenyl)-10-phenanthren-9-ylanthracen-9-yl]benzene-1,2,3-triamine |
|---|---|
| PubChem CID | 163806487 |
| Molecular Formula | C40H31N5 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 5-[2-(3,4-diaminophenyl)-10-phenanthren-9-ylanthracen-9-yl]benzene-1,2,3-triamine |
| SMILES | Nc1ccc(-c2ccc3c(-c4cc5ccccc5c5ccccc45)c4ccccc4c(-c4cc(N)c(N)c(N)c4)c3c2)cc1N |
| InChI | InChI=1S/C40H31N5/c41-34-16-14-23(19-35(34)42)22-13-15-31-33(17-22)38(25-20-36(43)40(45)37(44)21-25)29-11-5-6-12-30(29)39(31)32-18-24-7-1-2-8-26(24)27-9-3-4-10-28(27)32/h1-21H,41-45H2 |
| InChIKey | NJMCYXCXHMSMEO-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|