C18H25NO2S — CID 163806516
5-cyclopenta-1,4-dien-1-yl-N-[5-(hydroxymethyl)-6-sulfanylhexyl]cyclopenta-1,4-diene-1-carboxamide (PubChem CID 163806516) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 5-cyclopenta-1,4-dien-1-yl-N-[5-(hydroxymethyl)-6-sulfanylhexyl]cyclopenta-1,4-diene-1-carboxamide.
| Compound Name | 5-cyclopenta-1,4-dien-1-yl-N-[5-(hydroxymethyl)-6-sulfanylhexyl]cyclopenta-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 163806516 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 5-cyclopenta-1,4-dien-1-yl-N-[5-(hydroxymethyl)-6-sulfanylhexyl]cyclopenta-1,4-diene-1-carboxamide |
| SMILES | O=C(NCCCCC(CO)CS)C1=CCC=C1C1=CCC=C1 |
| InChI | InChI=1S/C18H25NO2S/c20-12-14(13-22)6-3-4-11-19-18(21)17-10-5-9-16(17)15-7-1-2-8-15/h1,7-10,14,20,22H,2-6,11-13H2,(H,19,21) |
| InChIKey | NJMXLWBWLGQIND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|