C22H29N7O2 — CID 163807947
2-amino-8-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-7-methylidene-5-(2-pyrrolidin-1-ylethyl)pteridin-6-one (PubChem CID 163807947) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-amino-8-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-7-methylidene-5-(2-pyrrolidin-1-ylethyl)pteridin-6-one.
| Compound Name | 2-amino-8-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-7-methylidene-5-(2-pyrrolidin-1-ylethyl)pteridin-6-one |
|---|---|
| PubChem CID | 163807947 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-amino-8-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-7-methylidene-5-(2-pyrrolidin-1-ylethyl)pteridin-6-one |
| SMILES | C=C1C(=O)N(CCN2CCCC2)c2cnc(N)nc2N1Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C22H29N7O2/c1-14-11-24-17(15(2)19(14)31-4)13-29-16(3)21(30)28(10-9-27-7-5-6-8-27)18-12-25-22(23)26-20(18)29/h11-12H,3,5-10,13H2,1-2,4H3,(H2,23,25,26) |
| InChIKey | NKRLBRLUETXVTH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|