C46H28N2O — CID 163809955
6-[4-(4-isocyanophenyl)phenyl]-2-(4-phenanthren-9-ylphenyl)-4-phenyl-1,3-benzoxazole (PubChem CID 163809955) has the molecular formula C46H28N2O and a molecular weight of 624.74 g/mol. Its IUPAC name is 6-[4-(4-isocyanophenyl)phenyl]-2-(4-phenanthren-9-ylphenyl)-4-phenyl-1,3-benzoxazole.
| Compound Name | 6-[4-(4-isocyanophenyl)phenyl]-2-(4-phenanthren-9-ylphenyl)-4-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 163809955 |
| Molecular Formula | C46H28N2O |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | 6-[4-(4-isocyanophenyl)phenyl]-2-(4-phenanthren-9-ylphenyl)-4-phenyl-1,3-benzoxazole |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3cc(-c4ccccc4)c4nc(-c5ccc(-c6cc7ccccc7c7ccccc67)cc5)oc4c3)cc2)cc1 |
| InChI | InChI=1S/C46H28N2O/c1-47-38-25-23-31(24-26-38)30-15-17-32(18-16-30)37-28-43(33-9-3-2-4-10-33)45-44(29-37)49-46(48-45)35-21-19-34(20-22-35)42-27-36-11-5-6-12-39(36)40-13-7-8-14-41(40)42/h2-29H |
| InChIKey | WOQPCJNBNZBUKM-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|