C19H17F5N4O4S — CID 163810218
ethyl 3-(3,4-difluorophenyl)-7-propan-2-yl-2-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyrimidine-6-carboximidate (PubChem CID 163810218) has the molecular formula C19H17F5N4O4S and a molecular weight of 492.43 g/mol. Its IUPAC name is ethyl 3-(3,4-difluorophenyl)-7-propan-2-yl-2-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyrimidine-6-carboximidate.
| Compound Name | ethyl 3-(3,4-difluorophenyl)-7-propan-2-yl-2-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyrimidine-6-carboximidate |
|---|---|
| PubChem CID | 163810218 |
| Molecular Formula | C19H17F5N4O4S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | ethyl 3-(3,4-difluorophenyl)-7-propan-2-yl-2-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyrimidine-6-carboximidate |
| SMILES | [H]/N=C(\OCC)c1cnc2c(-c3ccc(F)c(F)c3)c(OS(=O)(=O)C(F)(F)F)nn2c1C(C)C |
| InChI | InChI=1S/C19H17F5N4O4S/c1-4-31-16(25)11-8-26-17-14(10-5-6-12(20)13(21)7-10)18(27-28(17)15(11)9(2)3)32-33(29,30)19(22,23)24/h5-9,25H,4H2,1-3H3/b25-16- |
| InChIKey | NMPHDYNCSMSAIX-XYGWBWBKSA-N |
| XLogP | 4.39 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|