C26H37N9O2S — CID 163810556
(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]but-3-enamide (PubChem CID 163810556) has the molecular formula C26H37N9O2S and a molecular weight of 539.71 g/mol. Its IUPAC name is (2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]but-3-enamide.
| Compound Name | (2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]but-3-enamide |
|---|---|
| PubChem CID | 163810556 |
| Molecular Formula | C26H37N9O2S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | (2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]but-3-enamide |
| SMILES | C=C[C@@H](C(=O)NCCCC#Cc1cnc(Nc2nnc(C)s2)nc1NCCC)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C26H37N9O2S/c1-7-15-27-23-20(18-29-25(30-23)31-26-33-32-19(3)38-26)13-10-9-11-16-28-24(37)21(8-2)35(6)22(36)14-12-17-34(4)5/h8,12,14,18,21H,2,7,9,11,15-17H2,1,3-6H3,(H,28,37)(H2,27,29,30,31,33)/b14-12+/t21-/m0/s1 |
| InChIKey | NMWBNQPFGQFQFI-OSJHKOOESA-N |
| XLogP | 2.58 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|