About 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide
3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide (PubChem CID 163810787) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide |
| PubChem CID | 163810787 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide |
| SMILES | [H]/N=C1\C=C(S(=O)(=O)NC)C=CC1=O |
| InChI | InChI=1S/C7H8N2O3S/c1-9-13(11,12)5-2-3-7(10)6(8)4-5/h2-4,8-9H,1H3/b8-6+ |
| InChIKey | NNAWQXAXNWSWEY-SOFGYWHQSA-N |
| XLogP | -0.42 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide?
The IUPAC name of 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide (CID 163810787) is 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide.
What is the SMILES notation for 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide?
The canonical SMILES for 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide is [H]/N=C1\C=C(S(=O)(=O)NC)C=CC1=O.
What is the InChIKey of 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide?
The InChIKey is NNAWQXAXNWSWEY-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H8N2O3S/c1-9-13(11,12)5-2-3-7(10)6(8)4-5/h2-4,8-9H,1H3/b8-6+.
What are the key properties of 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide?
3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide has a molecular weight of 200.22 g/mol, XLogP of -0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-N-methyl-4-oxocyclohexa-1,5-diene-1-sulfonamide is sourced from PubChem (CID 163810787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).