About CID 163810914
CID 163810914 (PubChem CID 163810914) has the molecular formula C18H27BIO3
and a molecular weight of 429.13 g/mol.
Molecular Properties
| Compound Name | CID 163810914 |
| PubChem CID | 163810914 |
| Molecular Formula | C18H27BIO3 |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | — |
| SMILES | CCCCCC1[B]C(OC2=CC(OC(C)=O)CC(I)=C2)CCC1 |
| InChI | InChI=1S/C18H27BIO3/c1-3-4-5-7-14-8-6-9-18(19-14)23-17-11-15(20)10-16(12-17)22-13(2)21/h11-12,14,16,18H,3-10H2,1-2H3 |
| InChIKey | WASIRDLVPZDKPL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163810914 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163810914?
The IUPAC name of CID 163810914 (CID 163810914) is not available.
What is the SMILES notation for CID 163810914?
The canonical SMILES for CID 163810914 is CCCCCC1[B]C(OC2=CC(OC(C)=O)CC(I)=C2)CCC1.
What is the InChIKey of CID 163810914?
The InChIKey is WASIRDLVPZDKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27BIO3/c1-3-4-5-7-14-8-6-9-18(19-14)23-17-11-15(20)10-16(12-17)22-13(2)21/h11-12,14,16,18H,3-10H2,1-2H3.
What are the key properties of CID 163810914?
CID 163810914 has a molecular weight of 429.13 g/mol, XLogP of 5.12, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163810914 is sourced from PubChem (CID 163810914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).