C16H27ClN4 — CID 163812877
(E)-4-chloro-1-N-methyl-2-N-(4-piperidin-4-ylcyclohexa-2,4-dien-1-yl)but-2-ene-1,2,4-triamine (PubChem CID 163812877) has the molecular formula C16H27ClN4 and a molecular weight of 310.87 g/mol. Its IUPAC name is (E)-4-chloro-1-N-methyl-2-N-(4-piperidin-4-ylcyclohexa-2,4-dien-1-yl)but-2-ene-1,2,4-triamine.
| Compound Name | (E)-4-chloro-1-N-methyl-2-N-(4-piperidin-4-ylcyclohexa-2,4-dien-1-yl)but-2-ene-1,2,4-triamine |
|---|---|
| PubChem CID | 163812877 |
| Molecular Formula | C16H27ClN4 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (E)-4-chloro-1-N-methyl-2-N-(4-piperidin-4-ylcyclohexa-2,4-dien-1-yl)but-2-ene-1,2,4-triamine |
| SMILES | CNC/C(=C\C(N)Cl)NC1C=CC(C2CCNCC2)=CC1 |
| InChI | InChI=1S/C16H27ClN4/c1-19-11-15(10-16(17)18)21-14-4-2-12(3-5-14)13-6-8-20-9-7-13/h2-4,10,13-14,16,19-21H,5-9,11,18H2,1H3/b15-10+ |
| InChIKey | NOUCMRBHKPGNAF-XNTDXEJSSA-N |
| XLogP | 1.46 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|