About 4-methoxycyclohepta-3,5-dien-1-amine
4-methoxycyclohepta-3,5-dien-1-amine (PubChem CID 163813250) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-methoxycyclohepta-3,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-methoxycyclohepta-3,5-dien-1-amine |
| PubChem CID | 163813250 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-methoxycyclohepta-3,5-dien-1-amine |
| SMILES | COC1=CCC(N)CC=C1 |
| InChI | InChI=1S/C8H13NO/c1-10-8-4-2-3-7(9)5-6-8/h2,4,6-7H,3,5,9H2,1H3 |
| InChIKey | NPCUUCWADTYXBW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxycyclohepta-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohepta-3,5-dien-1-amine?
The IUPAC name of 4-methoxycyclohepta-3,5-dien-1-amine (CID 163813250) is 4-methoxycyclohepta-3,5-dien-1-amine.
What is the SMILES notation for 4-methoxycyclohepta-3,5-dien-1-amine?
The canonical SMILES for 4-methoxycyclohepta-3,5-dien-1-amine is COC1=CCC(N)CC=C1.
What is the InChIKey of 4-methoxycyclohepta-3,5-dien-1-amine?
The InChIKey is NPCUUCWADTYXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-10-8-4-2-3-7(9)5-6-8/h2,4,6-7H,3,5,9H2,1H3.
What are the key properties of 4-methoxycyclohepta-3,5-dien-1-amine?
4-methoxycyclohepta-3,5-dien-1-amine has a molecular weight of 139.20 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohepta-3,5-dien-1-amine is sourced from PubChem (CID 163813250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).