C12H17Cl2NO3S — CID 163813551
N-(2-phenylethyl)butanamide;sulfuryl dichloride (PubChem CID 163813551) has the molecular formula C12H17Cl2NO3S and a molecular weight of 326.25 g/mol. Its IUPAC name is N-(2-phenylethyl)butanamide;sulfuryl dichloride.
| Compound Name | N-(2-phenylethyl)butanamide;sulfuryl dichloride |
|---|---|
| PubChem CID | 163813551 |
| Molecular Formula | C12H17Cl2NO3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(2-phenylethyl)butanamide;sulfuryl dichloride |
| SMILES | CCCC(=O)NCCc1ccccc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C12H17NO.Cl2O2S/c1-2-6-12(14)13-10-9-11-7-4-3-5-8-11;1-5(2,3)4/h3-5,7-8H,2,6,9-10H2,1H3,(H,13,14); |
| InChIKey | NPIWANKVPVFPKL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |