C20H46N8O — CID 163813884
2,6-diamino-N-(2-aminoethyl)-N-[2-[2-aminoethyl-[(E)-4,8-diaminooct-2-en-3-yl]amino]ethyl]hexanamide (PubChem CID 163813884) has the molecular formula C20H46N8O and a molecular weight of 414.64 g/mol. Its IUPAC name is 2,6-diamino-N-(2-aminoethyl)-N-[2-[2-aminoethyl-[(E)-4,8-diaminooct-2-en-3-yl]amino]ethyl]hexanamide.
| Compound Name | 2,6-diamino-N-(2-aminoethyl)-N-[2-[2-aminoethyl-[(E)-4,8-diaminooct-2-en-3-yl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 163813884 |
| Molecular Formula | C20H46N8O |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.38 |
| IUPAC Name | 2,6-diamino-N-(2-aminoethyl)-N-[2-[2-aminoethyl-[(E)-4,8-diaminooct-2-en-3-yl]amino]ethyl]hexanamide |
| SMILES | C/C=C(\C(N)CCCCN)N(CCN)CCN(CCN)C(=O)C(N)CCCCN |
| InChI | InChI=1S/C20H46N8O/c1-2-19(17(25)7-3-5-9-21)27(13-11-23)15-16-28(14-12-24)20(29)18(26)8-4-6-10-22/h2,17-18H,3-16,21-26H2,1H3/b19-2+ |
| InChIKey | NPQRSNAWGNMRTA-FQJNFEMKSA-N |
| XLogP | -1.15 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|