C25H28N4O3S — CID 163813996
5-[5-[(3S,4E,6E)-3-methyl-7-(2-oxa-7-azaspiro[3.4]octan-7-yl)octa-1,4,6-trien-4-yl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one (PubChem CID 163813996) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 5-[5-[(3S,4E,6E)-3-methyl-7-(2-oxa-7-azaspiro[3.4]octan-7-yl)octa-1,4,6-trien-4-yl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[5-[(3S,4E,6E)-3-methyl-7-(2-oxa-7-azaspiro[3.4]octan-7-yl)octa-1,4,6-trien-4-yl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 163813996 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 5-[5-[(3S,4E,6E)-3-methyl-7-(2-oxa-7-azaspiro[3.4]octan-7-yl)octa-1,4,6-trien-4-yl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| SMILES | C=C[C@H](C)/C(=C\C=C(/C)N1CCC2(COC2)C1)c1ccc2c(cnn2C2=CC(=O)NS2=O)c1 |
| InChI | InChI=1S/C25H28N4O3S/c1-4-17(2)21(7-5-18(3)28-10-9-25(14-28)15-32-16-25)19-6-8-22-20(11-19)13-26-29(22)24-12-23(30)27-33(24)31/h4-8,11-13,17H,1,9-10,14-16H2,2-3H3,(H,27,30)/b18-5+,21-7+/t17-,33?/m0/s1 |
| InChIKey | NPTBTMXWIRILAD-MZKWINSGSA-N |
| XLogP | 3.46 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|