C12H15N — CID 163814256
(2Z,3E)-2-[(2E,4Z)-hepta-2,4-dienylidene]-3-prop-2-enylideneaziridine (PubChem CID 163814256) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (2Z,3E)-2-[(2E,4Z)-hepta-2,4-dienylidene]-3-prop-2-enylideneaziridine.
| Compound Name | (2Z,3E)-2-[(2E,4Z)-hepta-2,4-dienylidene]-3-prop-2-enylideneaziridine |
|---|---|
| PubChem CID | 163814256 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2Z,3E)-2-[(2E,4Z)-hepta-2,4-dienylidene]-3-prop-2-enylideneaziridine |
| SMILES | C=C/C=C1/N/C1=C\C=C\C=C/CC |
| InChI | InChI=1S/C12H15N/c1-3-5-6-7-8-10-12-11(13-12)9-4-2/h4-10,13H,2-3H2,1H3/b6-5-,8-7+,11-9+,12-10- |
| InChIKey | NPYFAGWUJNWFIM-CRVDCGBSSA-N |
| XLogP | 3.07 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|