C24H35N — CID 163814484
N-(2,4-ditert-butylphenyl)-N,2,3,5-tetramethylaniline (PubChem CID 163814484) has the molecular formula C24H35N and a molecular weight of 337.55 g/mol. Its IUPAC name is N-(2,4-ditert-butylphenyl)-N,2,3,5-tetramethylaniline.
| Compound Name | N-(2,4-ditert-butylphenyl)-N,2,3,5-tetramethylaniline |
|---|---|
| PubChem CID | 163814484 |
| Molecular Formula | C24H35N |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | N-(2,4-ditert-butylphenyl)-N,2,3,5-tetramethylaniline |
| SMILES | Cc1cc(C)c(C)c(N(C)c2ccc(C(C)(C)C)cc2C(C)(C)C)c1 |
| InChI | InChI=1S/C24H35N/c1-16-13-17(2)18(3)22(14-16)25(10)21-12-11-19(23(4,5)6)15-20(21)24(7,8)9/h11-15H,1-10H3 |
| InChIKey | WMVQQOGDQQQUOJ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |