C21H16Cl2N2O4 — CID 163814623
3-[11-(2-carboxyethyl)-7,8-dichloroindeno[1,2-b]quinoxalin-11-yl]propanoic acid (PubChem CID 163814623) has the molecular formula C21H16Cl2N2O4 and a molecular weight of 431.28 g/mol. Its IUPAC name is 3-[11-(2-carboxyethyl)-7,8-dichloroindeno[1,2-b]quinoxalin-11-yl]propanoic acid.
| Compound Name | 3-[11-(2-carboxyethyl)-7,8-dichloroindeno[1,2-b]quinoxalin-11-yl]propanoic acid |
|---|---|
| PubChem CID | 163814623 |
| Molecular Formula | C21H16Cl2N2O4 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3-[11-(2-carboxyethyl)-7,8-dichloroindeno[1,2-b]quinoxalin-11-yl]propanoic acid |
| SMILES | O=C(O)CCC1(CCC(=O)O)c2ccccc2-c2nc3cc(Cl)c(Cl)cc3nc21 |
| InChI | InChI=1S/C21H16Cl2N2O4/c22-13-9-15-16(10-14(13)23)25-20-19(24-15)11-3-1-2-4-12(11)21(20,7-5-17(26)27)8-6-18(28)29/h1-4,9-10H,5-8H2,(H,26,27)(H,28,29) |
| InChIKey | NQFJXTDPLUEYEY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |