About 4-pent-1-en-2-yloxane
4-pent-1-en-2-yloxane (PubChem CID 163815206) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 4-pent-1-en-2-yloxane.
Molecular Properties
| Compound Name | 4-pent-1-en-2-yloxane |
| PubChem CID | 163815206 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 4-pent-1-en-2-yloxane |
| SMILES | C=C(CCC)C1CCOCC1 |
| InChI | InChI=1S/C10H18O/c1-3-4-9(2)10-5-7-11-8-6-10/h10H,2-8H2,1H3 |
| InChIKey | NQSWWDQYMDBFLD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-pent-1-en-2-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pent-1-en-2-yloxane?
The IUPAC name of 4-pent-1-en-2-yloxane (CID 163815206) is 4-pent-1-en-2-yloxane.
What is the SMILES notation for 4-pent-1-en-2-yloxane?
The canonical SMILES for 4-pent-1-en-2-yloxane is C=C(CCC)C1CCOCC1.
What is the InChIKey of 4-pent-1-en-2-yloxane?
The InChIKey is NQSWWDQYMDBFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-3-4-9(2)10-5-7-11-8-6-10/h10H,2-8H2,1H3.
What are the key properties of 4-pent-1-en-2-yloxane?
4-pent-1-en-2-yloxane has a molecular weight of 154.25 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pent-1-en-2-yloxane is sourced from PubChem (CID 163815206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).