C34H41N3O4 — CID 163815746
tert-butyl N-[3-[4-[6-[(1E,3E)-3-carbamoyl-1-methoxypenta-1,3-dienyl]-3-phenyl-2-pyridinyl]phenyl]pentan-3-yl]carbamate (PubChem CID 163815746) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[6-[(1E,3E)-3-carbamoyl-1-methoxypenta-1,3-dienyl]-3-phenyl-2-pyridinyl]phenyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[6-[(1E,3E)-3-carbamoyl-1-methoxypenta-1,3-dienyl]-3-phenyl-2-pyridinyl]phenyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 163815746 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | tert-butyl N-[3-[4-[6-[(1E,3E)-3-carbamoyl-1-methoxypenta-1,3-dienyl]-3-phenyl-2-pyridinyl]phenyl]pentan-3-yl]carbamate |
| SMILES | C/C=C(\C=C(\OC)c1ccc(-c2ccccc2)c(-c2ccc(C(CC)(CC)NC(=O)OC(C)(C)C)cc2)n1)C(N)=O |
| InChI | InChI=1S/C34H41N3O4/c1-8-23(31(35)38)22-29(40-7)28-21-20-27(24-14-12-11-13-15-24)30(36-28)25-16-18-26(19-17-25)34(9-2,10-3)37-32(39)41-33(4,5)6/h8,11-22H,9-10H2,1-7H3,(H2,35,38)(H,37,39)/b23-8+,29-22+ |
| InChIKey | NREGPRXYLSZVEJ-JCNFMMGWSA-N |
| XLogP | 7.37 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|