C14H21N3O12 — CID 163815874
6-[(2S,3R)-2,4-dihydroxy-3-[(2-nitroimidazol-1-yl)methoxy]butoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163815874) has the molecular formula C14H21N3O12 and a molecular weight of 423.33 g/mol. Its IUPAC name is 6-[(2S,3R)-2,4-dihydroxy-3-[(2-nitroimidazol-1-yl)methoxy]butoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[(2S,3R)-2,4-dihydroxy-3-[(2-nitroimidazol-1-yl)methoxy]butoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163815874 |
| Molecular Formula | C14H21N3O12 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 6-[(2S,3R)-2,4-dihydroxy-3-[(2-nitroimidazol-1-yl)methoxy]butoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(OC[C@H](O)[C@@H](CO)OCn2ccnc2[N+](=O)[O-])C(O)C(O)C1O |
| InChI | InChI=1S/C14H21N3O12/c18-3-7(28-5-16-2-1-15-14(16)17(25)26)6(19)4-27-13-10(22)8(20)9(21)11(29-13)12(23)24/h1-2,6-11,13,18-22H,3-5H2,(H,23,24)/t6-,7+,8?,9?,10?,11?,13?/m0/s1 |
| InChIKey | NRGTZBQQTXBPRJ-KPMWLMEISA-N |
| XLogP | -3.60 |
| TPSA | 227.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|