C17H18ClF3N4O2S — CID 163816323
1-[(2'S,6'S)-2-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone (PubChem CID 163816323) has the molecular formula C17H18ClF3N4O2S and a molecular weight of 434.87 g/mol. Its IUPAC name is 1-[(2'S,6'S)-2-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2'S,6'S)-2-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 163816323 |
| Molecular Formula | C17H18ClF3N4O2S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-[(2'S,6'S)-2-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@H]1CC2(C[C@@H](c3cn(C)nn3)N1C(=O)C(F)(F)F)OCCc1sc(Cl)cc12 |
| InChI | InChI=1S/C17H18ClF3N4O2S/c1-9-6-16(10-5-14(18)28-13(10)3-4-27-16)7-12(11-8-24(2)23-22-11)25(9)15(26)17(19,20)21/h5,8-9,12H,3-4,6-7H2,1-2H3/t9-,12-,16?/m0/s1 |
| InChIKey | NRQAOWNHBNALJA-SSIRTSJXSA-N |
| XLogP | 3.61 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |