About (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine
(2S)-N,1-diethoxy-2-methylhex-5-en-3-amine (PubChem CID 163816690) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine.
Molecular Properties
| Compound Name | (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine |
| PubChem CID | 163816690 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine |
| SMILES | C=CCC(NOCC)[C@H](C)COCC |
| InChI | InChI=1S/C11H23NO2/c1-5-8-11(12-14-7-3)10(4)9-13-6-2/h5,10-12H,1,6-9H2,2-4H3/t10-,11?/m1/s1 |
| InChIKey | NRYGGRLMPWRULD-NFJWQWPMSA-N |
| XLogP | 2.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine?
The IUPAC name of (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine (CID 163816690) is (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine.
What is the SMILES notation for (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine?
The canonical SMILES for (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine is C=CCC(NOCC)[C@H](C)COCC.
What is the InChIKey of (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine?
The InChIKey is NRYGGRLMPWRULD-NFJWQWPMSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-8-11(12-14-7-3)10(4)9-13-6-2/h5,10-12H,1,6-9H2,2-4H3/t10-,11?/m1/s1.
What are the key properties of (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine?
(2S)-N,1-diethoxy-2-methylhex-5-en-3-amine has a molecular weight of 201.31 g/mol, XLogP of 2.14, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,1-diethoxy-2-methylhex-5-en-3-amine is sourced from PubChem (CID 163816690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).