C25H30ClN3O3 — CID 163817348
3-[(4aR,7aR)-6-(4-ethoxybenzoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N-(4-chlorophenyl)propanamide (PubChem CID 163817348) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is 3-[(4aR,7aR)-6-(4-ethoxybenzoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N-(4-chlorophenyl)propanamide.
| Compound Name | 3-[(4aR,7aR)-6-(4-ethoxybenzoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N-(4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 163817348 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[(4aR,7aR)-6-(4-ethoxybenzoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-N-(4-chlorophenyl)propanamide |
| SMILES | CCOc1ccc(C(=O)N2C[C@H]3CCCN(CCC(=O)Nc4ccc(Cl)cc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-2-32-22-11-5-18(6-12-22)25(31)29-16-19-4-3-14-28(23(19)17-29)15-13-24(30)27-21-9-7-20(26)8-10-21/h5-12,19,23H,2-4,13-17H2,1H3,(H,27,30)/t19-,23+/m1/s1 |
| InChIKey | NSLWDBZEVXIPND-XXBNENTESA-N |
| XLogP | 4.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |