C7H16N2O4 — CID 163818041
2,3,4,5-tetrahydroxyheptanimidamide (PubChem CID 163818041) has the molecular formula C7H16N2O4 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxyheptanimidamide.
| Compound Name | 2,3,4,5-tetrahydroxyheptanimidamide |
|---|---|
| PubChem CID | 163818041 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2,3,4,5-tetrahydroxyheptanimidamide |
| SMILES | [H]/N=C(\N)C(O)C(O)C(O)C(O)CC |
| InChI | InChI=1S/C7H16N2O4/c1-2-3(10)4(11)5(12)6(13)7(8)9/h3-6,10-13H,2H2,1H3,(H3,8,9) |
| InChIKey | LQYKSICOOHFTLQ-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|