About 4-methoxypent-4-ene-2,3-diamine
4-methoxypent-4-ene-2,3-diamine (PubChem CID 163818178) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 4-methoxypent-4-ene-2,3-diamine.
Molecular Properties
| Compound Name | 4-methoxypent-4-ene-2,3-diamine |
| PubChem CID | 163818178 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 4-methoxypent-4-ene-2,3-diamine |
| SMILES | C=C(OC)C(N)C(C)N |
| InChI | InChI=1S/C6H14N2O/c1-4(7)6(8)5(2)9-3/h4,6H,2,7-8H2,1,3H3 |
| InChIKey | NTCTYPKVAARSLS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxypent-4-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypent-4-ene-2,3-diamine?
The IUPAC name of 4-methoxypent-4-ene-2,3-diamine (CID 163818178) is 4-methoxypent-4-ene-2,3-diamine.
What is the SMILES notation for 4-methoxypent-4-ene-2,3-diamine?
The canonical SMILES for 4-methoxypent-4-ene-2,3-diamine is C=C(OC)C(N)C(C)N.
What is the InChIKey of 4-methoxypent-4-ene-2,3-diamine?
The InChIKey is NTCTYPKVAARSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-4(7)6(8)5(2)9-3/h4,6H,2,7-8H2,1,3H3.
What are the key properties of 4-methoxypent-4-ene-2,3-diamine?
4-methoxypent-4-ene-2,3-diamine has a molecular weight of 130.19 g/mol, XLogP of -0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypent-4-ene-2,3-diamine is sourced from PubChem (CID 163818178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).