About (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate
(5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate (PubChem CID 163818266) has the molecular formula C13H17FO3
and a molecular weight of 240.27 g/mol. Its IUPAC name is (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate.
Molecular Properties
| Compound Name | (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate |
| PubChem CID | 163818266 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate |
| SMILES | COC12CC3CC4(CC4(COC(=O)CF)C1)C32 |
| InChI | InChI=1S/C13H17FO3/c1-16-13-3-8-2-12(10(8)13)5-11(12,6-13)7-17-9(15)4-14/h8,10H,2-7H2,1H3 |
| InChIKey | NTEPLAWRFGRWFE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate?
The IUPAC name of (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate (CID 163818266) is (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate.
What is the SMILES notation for (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate?
The canonical SMILES for (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate is COC12CC3CC4(CC4(COC(=O)CF)C1)C32.
What is the InChIKey of (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate?
The InChIKey is NTEPLAWRFGRWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO3/c1-16-13-3-8-2-12(10(8)13)5-11(12,6-13)7-17-9(15)4-14/h8,10H,2-7H2,1H3.
What are the key properties of (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate?
(5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate has a molecular weight of 240.27 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-3-tetracyclo[3.3.1.01,3.07,9]nonanyl)methyl 2-fluoroacetate is sourced from PubChem (CID 163818266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).