About 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate
4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate (PubChem CID 163818360) has the molecular formula C7H6NO4S-
and a molecular weight of 200.19 g/mol. Its IUPAC name is 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate.
Molecular Properties
| Compound Name | 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate |
| PubChem CID | 163818360 |
| Molecular Formula | C7H6NO4S- |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate |
| SMILES | Nc1c([O-])ccc2c1S(=O)(=O)CO2 |
| InChI | InChI=1S/C7H7NO4S/c8-6-4(9)1-2-5-7(6)13(10,11)3-12-5/h1-2,9H,3,8H2/p-1 |
| InChIKey | NTGOOLXNHGWUBO-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate?
The IUPAC name of 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate (CID 163818360) is 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate.
What is the SMILES notation for 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate?
The canonical SMILES for 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate is Nc1c([O-])ccc2c1S(=O)(=O)CO2.
What is the InChIKey of 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate?
The InChIKey is NTGOOLXNHGWUBO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO4S/c8-6-4(9)1-2-5-7(6)13(10,11)3-12-5/h1-2,9H,3,8H2/p-1.
What are the key properties of 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate?
4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate has a molecular weight of 200.19 g/mol, XLogP of -0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,3-dioxo-1,3λ6-benzoxathiol-5-olate is sourced from PubChem (CID 163818360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).