About 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene
2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene (PubChem CID 163818511) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene |
| PubChem CID | 163818511 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene |
| SMILES | C#CC1=C(C)CC(OC)C=C1C |
| InChI | InChI=1S/C11H14O/c1-5-11-8(2)6-10(12-4)7-9(11)3/h1,6,10H,7H2,2-4H3 |
| InChIKey | NTKFIALVFCXOCR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene?
The IUPAC name of 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene (CID 163818511) is 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene is C#CC1=C(C)CC(OC)C=C1C.
What is the InChIKey of 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene?
The InChIKey is NTKFIALVFCXOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-5-11-8(2)6-10(12-4)7-9(11)3/h1,6,10H,7H2,2-4H3.
What are the key properties of 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene?
2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene has a molecular weight of 162.23 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-5-methoxy-1,3-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 163818511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).