About 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine
9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine (PubChem CID 163818585) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine.
Molecular Properties
| Compound Name | 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine |
| PubChem CID | 163818585 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine |
| SMILES | CCN1c2cc(N)ccc2C2(C)C=CC(C)CC12 |
| InChI | InChI=1S/C16H22N2/c1-4-18-14-10-12(17)5-6-13(14)16(3)8-7-11(2)9-15(16)18/h5-8,10-11,15H,4,9,17H2,1-3H3 |
| InChIKey | NTLOROAACLWSQY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine?
The IUPAC name of 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine (CID 163818585) is 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine.
What is the SMILES notation for 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine?
The canonical SMILES for 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine is CCN1c2cc(N)ccc2C2(C)C=CC(C)CC12.
What is the InChIKey of 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine?
The InChIKey is NTLOROAACLWSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-4-18-14-10-12(17)5-6-13(14)16(3)8-7-11(2)9-15(16)18/h5-8,10-11,15H,4,9,17H2,1-3H3.
What are the key properties of 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine?
9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine has a molecular weight of 242.37 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-4b,7-dimethyl-8,8a-dihydro-7H-carbazol-2-amine is sourced from PubChem (CID 163818585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).