C27H29NO8 — CID 163819115
20-[6-(2-hydroxyethoxy)hexyl]-15,16-bis(hydroxymethyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione (PubChem CID 163819115) has the molecular formula C27H29NO8 and a molecular weight of 495.53 g/mol. Its IUPAC name is 20-[6-(2-hydroxyethoxy)hexyl]-15,16-bis(hydroxymethyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione.
| Compound Name | 20-[6-(2-hydroxyethoxy)hexyl]-15,16-bis(hydroxymethyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione |
|---|---|
| PubChem CID | 163819115 |
| Molecular Formula | C27H29NO8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 20-[6-(2-hydroxyethoxy)hexyl]-15,16-bis(hydroxymethyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13(18),14,16-heptaene-11,19-dione |
| SMILES | O=C1c2cc3c(cc2-c2c1c1cc(CO)c(CO)cc1c(=O)n2CCCCCCOCCO)OCO3 |
| InChI | InChI=1S/C27H29NO8/c29-6-8-34-7-4-2-1-3-5-28-25-19-11-22-23(36-15-35-22)12-20(19)26(32)24(25)18-9-16(13-30)17(14-31)10-21(18)27(28)33/h9-12,29-31H,1-8,13-15H2 |
| InChIKey | KZKMEHXKFPFZDQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|