C50H35N3O — CID 163820013
4-[4-[4-(7-ethynyl-9,9-dimethylfluoren-2-yl)dibenzofuran-3-yl]phenyl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine (PubChem CID 163820013) has the molecular formula C50H35N3O and a molecular weight of 693.85 g/mol. Its IUPAC name is 4-[4-[4-(7-ethynyl-9,9-dimethylfluoren-2-yl)dibenzofuran-3-yl]phenyl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine.
| Compound Name | 4-[4-[4-(7-ethynyl-9,9-dimethylfluoren-2-yl)dibenzofuran-3-yl]phenyl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163820013 |
| Molecular Formula | C50H35N3O |
| Molecular Weight | 693.85 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | 4-[4-[4-(7-ethynyl-9,9-dimethylfluoren-2-yl)dibenzofuran-3-yl]phenyl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine |
| SMILES | C#Cc1ccc2c(c1)C(C)(C)c1cc(-c3c(-c4ccc(C5=NC(c6ccccc6)NC(c6ccccc6)=N5)cc4)ccc4c3oc3ccccc34)ccc1-2 |
| InChI | InChI=1S/C50H35N3O/c1-4-31-19-25-38-39-26-24-36(30-43(39)50(2,3)42(38)29-31)45-37(27-28-41-40-17-11-12-18-44(40)54-46(41)45)32-20-22-35(23-21-32)49-52-47(33-13-7-5-8-14-33)51-48(53-49)34-15-9-6-10-16-34/h1,5-30,47H,2-3H3,(H,51,52,53) |
| InChIKey | NUOJYPXHCFZQFH-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.85 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|