C10H8N2OS — CID 163820674
(2E,4E)-2-ethenyl-5-(2-oxo-1,3-thiazol-3-yl)penta-2,4-dienenitrile (PubChem CID 163820674) has the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-(2-oxo-1,3-thiazol-3-yl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-2-ethenyl-5-(2-oxo-1,3-thiazol-3-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 163820674 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-(2-oxo-1,3-thiazol-3-yl)penta-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C=C\n1ccsc1=O |
| InChI | InChI=1S/C10H8N2OS/c1-2-9(8-11)4-3-5-12-6-7-14-10(12)13/h2-7H,1H2/b5-3+,9-4+ |
| InChIKey | NVCVKLXNNAGFNU-BMVOEDMYSA-N |
| XLogP | 2.02 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|