C17H22ClN4+ — CID 163821168
[1-[5-(2-chlorophenyl)-6-methylpyrazin-2-yl]-4-methylpiperidin-4-yl]azanium (PubChem CID 163821168) has the molecular formula C17H22ClN4+ and a molecular weight of 317.84 g/mol. Its IUPAC name is [1-[5-(2-chlorophenyl)-6-methylpyrazin-2-yl]-4-methylpiperidin-4-yl]azanium.
| Compound Name | [1-[5-(2-chlorophenyl)-6-methylpyrazin-2-yl]-4-methylpiperidin-4-yl]azanium |
|---|---|
| PubChem CID | 163821168 |
| Molecular Formula | C17H22ClN4+ |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [1-[5-(2-chlorophenyl)-6-methylpyrazin-2-yl]-4-methylpiperidin-4-yl]azanium |
| SMILES | Cc1nc(N2CCC(C)([NH3+])CC2)cnc1-c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN4/c1-12-16(13-5-3-4-6-14(13)18)20-11-15(21-12)22-9-7-17(2,19)8-10-22/h3-6,11H,7-10,19H2,1-2H3/p+1 |
| InChIKey | NVNGEXSHHAWRSU-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 56.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |