C19H22N6 — CID 163821520
1-[6-[[3-(1H-pyrazol-4-yl)phenyl]methyl]pyridazin-3-yl]piperidin-4-amine (PubChem CID 163821520) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-[6-[[3-(1H-pyrazol-4-yl)phenyl]methyl]pyridazin-3-yl]piperidin-4-amine.
| Compound Name | 1-[6-[[3-(1H-pyrazol-4-yl)phenyl]methyl]pyridazin-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 163821520 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[6-[[3-(1H-pyrazol-4-yl)phenyl]methyl]pyridazin-3-yl]piperidin-4-amine |
| SMILES | NC1CCN(c2ccc(Cc3cccc(-c4cn[nH]c4)c3)nn2)CC1 |
| InChI | InChI=1S/C19H22N6/c20-17-6-8-25(9-7-17)19-5-4-18(23-24-19)11-14-2-1-3-15(10-14)16-12-21-22-13-16/h1-5,10,12-13,17H,6-9,11,20H2,(H,21,22) |
| InChIKey | NVVVUURUOOKYTM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |