About (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane
(8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane (PubChem CID 163822352) has the molecular formula C11H15F3
and a molecular weight of 204.23 g/mol. Its IUPAC name is (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane.
Molecular Properties
| Compound Name | (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane |
| PubChem CID | 163822352 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane |
| SMILES | FC(F)(F)[C@H]1CCC2C3CCC3CC21 |
| InChI | InChI=1S/C11H15F3/c12-11(13,14)10-4-3-8-7-2-1-6(7)5-9(8)10/h6-10H,1-5H2/t6?,7?,8?,9?,10-/m0/s1 |
| InChIKey | NWMIBJPVLODEBB-XZXVQBCNSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane?
The IUPAC name of (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane (CID 163822352) is (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane.
What is the SMILES notation for (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane?
The canonical SMILES for (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane is FC(F)(F)[C@H]1CCC2C3CCC3CC21.
What is the InChIKey of (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane?
The InChIKey is NWMIBJPVLODEBB-XZXVQBCNSA-N. The full InChI is InChI=1S/C11H15F3/c12-11(13,14)10-4-3-8-7-2-1-6(7)5-9(8)10/h6-10H,1-5H2/t6?,7?,8?,9?,10-/m0/s1.
What are the key properties of (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane?
(8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane has a molecular weight of 204.23 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-8-(trifluoromethyl)tricyclo[5.3.0.02,5]decane is sourced from PubChem (CID 163822352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).