C13H15IN4 — CID 163822384
1-(3,5-dimethylcyclohexa-1,5-dien-1-yl)-4-iodo-6,7-dihydropyrazolo[5,4-d]pyrimidine (PubChem CID 163822384) has the molecular formula C13H15IN4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexa-1,5-dien-1-yl)-4-iodo-6,7-dihydropyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-(3,5-dimethylcyclohexa-1,5-dien-1-yl)-4-iodo-6,7-dihydropyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 163822384 |
| Molecular Formula | C13H15IN4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 1-(3,5-dimethylcyclohexa-1,5-dien-1-yl)-4-iodo-6,7-dihydropyrazolo[5,4-d]pyrimidine |
| SMILES | CC1=CC(n2ncc3c2NCN=C3I)=CC(C)C1 |
| InChI | InChI=1S/C13H15IN4/c1-8-3-9(2)5-10(4-8)18-13-11(6-17-18)12(14)15-7-16-13/h4-6,8,16H,3,7H2,1-2H3 |
| InChIKey | NWNCDLCLCUCLGM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|