C61H42N4O — CID 163822470
N-[(1Z)-3-dibenzofuran-3-yl-1-[3-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]buta-1,3-dienyl]-1-phenylethanimine (PubChem CID 163822470) has the molecular formula C61H42N4O and a molecular weight of 847.03 g/mol. Its IUPAC name is N-[(1Z)-3-dibenzofuran-3-yl-1-[3-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]buta-1,3-dienyl]-1-phenylethanimine.
| Compound Name | N-[(1Z)-3-dibenzofuran-3-yl-1-[3-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]buta-1,3-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 163822470 |
| Molecular Formula | C61H42N4O |
| Molecular Weight | 847.03 g/mol |
| Exact Mass | 846.34 |
| IUPAC Name | N-[(1Z)-3-dibenzofuran-3-yl-1-[3-[3-[4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]buta-1,3-dienyl]-1-phenylethanimine |
| SMILES | C=C(/C=C(\N=C(/C)c1ccccc1)c1cccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc6ccccc6c5)cc4)n3)c2)c1)c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C61H42N4O/c1-40(47-33-34-55-54-25-11-12-26-57(54)66-58(55)39-47)35-56(62-41(2)42-15-5-3-6-16-42)52-23-13-21-49(37-52)50-22-14-24-53(38-50)61-64-59(45-18-7-4-8-19-45)63-60(65-61)46-30-27-44(28-31-46)51-32-29-43-17-9-10-20-48(43)36-51/h3-39H,1H2,2H3/b56-35-,62-41+ |
| InChIKey | NWOYOYLLKHNSLA-BYKAWOIGSA-N |
| XLogP | 15.82 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.03 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|