C28H18ClN5+4 — CID 163822852
1-(9-chloro-1,10-phenanthrolin-1-ium-1-yl)-2,18,19-triazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene (PubChem CID 163822852) has the molecular formula C28H18ClN5+4 and a molecular weight of 459.94 g/mol. Its IUPAC name is 1-(9-chloro-1,10-phenanthrolin-1-ium-1-yl)-2,18,19-triazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene.
| Compound Name | 1-(9-chloro-1,10-phenanthrolin-1-ium-1-yl)-2,18,19-triazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 163822852 |
| Molecular Formula | C28H18ClN5+4 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-(9-chloro-1,10-phenanthrolin-1-ium-1-yl)-2,18,19-triazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8(19),9,11,13,15,17-nonaene |
| SMILES | Clc1ccc2ccc3ccc[n+](C45[n+]6ccccc6-c6cccc([n+]64)-c4cccc[n+]45)c3c2n1 |
| InChI | InChI=1S/C28H18ClN5/c29-25-15-14-19-12-13-20-7-6-18-33(27(20)26(19)30-25)28-31-16-3-1-8-21(31)23-10-5-11-24(34(23)28)22-9-2-4-17-32(22)28/h1-18H/q+4 |
| InChIKey | YPXXUHYBOVPXQE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|