C10H10N2O2 — CID 163822944
1-(3,5-dimethylphenyl)-1,3-diazetidine-2,4-dione (PubChem CID 163822944) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-1,3-diazetidine-2,4-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-1,3-diazetidine-2,4-dione |
|---|---|
| PubChem CID | 163822944 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-1,3-diazetidine-2,4-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)NC2=O)c1 |
| InChI | InChI=1S/C10H10N2O2/c1-6-3-7(2)5-8(4-6)12-9(13)11-10(12)14/h3-5H,1-2H3,(H,11,13,14) |
| InChIKey | NWZIAWCTLJMYIS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |