C32H45NO5 — CID 163823015
methyl 2-[[(6aS,6bS,8aS,11R,12aR,14aR)-11-carbamoyl-2-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-2H-picen-3-yl]oxy]acetate (PubChem CID 163823015) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is methyl 2-[[(6aS,6bS,8aS,11R,12aR,14aR)-11-carbamoyl-2-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-2H-picen-3-yl]oxy]acetate.
| Compound Name | methyl 2-[[(6aS,6bS,8aS,11R,12aR,14aR)-11-carbamoyl-2-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-2H-picen-3-yl]oxy]acetate |
|---|---|
| PubChem CID | 163823015 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | methyl 2-[[(6aS,6bS,8aS,11R,12aR,14aR)-11-carbamoyl-2-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydro-2H-picen-3-yl]oxy]acetate |
| SMILES | COC(=O)COC1=C(C)C2=CC=C3[C@@](C)(CC[C@@]4(C)[C@@H]5C[C@](C)(C(N)=O)CC[C@]5(C)CC[C@]34C)C2=CC1O |
| InChI | InChI=1S/C32H45NO5/c1-19-20-8-9-23-30(4,21(20)16-22(34)26(19)38-18-25(35)37-7)13-15-32(6)24-17-29(3,27(33)36)11-10-28(24,2)12-14-31(23,32)5/h8-9,16,22,24,34H,10-15,17-18H2,1-7H3,(H2,33,36)/t22?,24-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | NXANNGFQULDOLZ-RMQSCLQYSA-N |
| XLogP | 5.52 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |