About [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone
[(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 163823506) has the molecular formula C13H16F2N2O2S
and a molecular weight of 302.35 g/mol. Its IUPAC name is [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 163823506 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | C=C(OCC)c1nc(C(=O)N2CC(F)(F)C[C@@H]2C)cs1 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-4-19-9(3)11-16-10(6-20-11)12(18)17-7-13(14,15)5-8(17)2/h6,8H,3-5,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | NXKXUVXLFXHCJS-QMMMGPOBSA-N |
| XLogP | 3.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone (CID 163823506) is [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone is C=C(OCC)c1nc(C(=O)N2CC(F)(F)C[C@@H]2C)cs1.
What is the InChIKey of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone?
The InChIKey is NXKXUVXLFXHCJS-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H16F2N2O2S/c1-4-19-9(3)11-16-10(6-20-11)12(18)17-7-13(14,15)5-8(17)2/h6,8H,3-5,7H2,1-2H3/t8-/m0/s1.
What are the key properties of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone?
[(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone has a molecular weight of 302.35 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-[2-(1-ethoxyethenyl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 163823506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).