About methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium
methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium (PubChem CID 163824018) has the molecular formula C6H11F3N+
and a molecular weight of 154.16 g/mol. Its IUPAC name is methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium.
Analyze methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium?
The IUPAC name of methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium (CID 163824018) is methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium.
What is the SMILES notation for methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium?
The canonical SMILES for methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium is C[NH2+]C(C)=C(C)C(F)(F)F.
What is the InChIKey of methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium?
The InChIKey is NXVSZURTIKFQOG-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H10F3N/c1-4(5(2)10-3)6(7,8)9/h10H,1-3H3/p+1.
What are the key properties of methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium?
methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium has a molecular weight of 154.16 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(4,4,4-trifluoro-3-methylbut-2-en-2-yl)azanium is sourced from PubChem (CID 163824018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).