About 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one
1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one (PubChem CID 163824238) has the molecular formula C21H20N2O3S2
and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one |
| PubChem CID | 163824238 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(C(=O)N2CCC(Oc3nccs3)C2)s1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3S2/c24-18(15-4-2-1-3-5-15)8-6-17-7-9-19(28-17)20(25)23-12-10-16(14-23)26-21-22-11-13-27-21/h1-5,7,9,11,13,16H,6,8,10,12,14H2 |
| InChIKey | NYAOXAGBDJJTRC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one?
The IUPAC name of 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one (CID 163824238) is 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one.
What is the SMILES notation for 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one?
The canonical SMILES for 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one is O=C(CCc1ccc(C(=O)N2CCC(Oc3nccs3)C2)s1)c1ccccc1.
What is the InChIKey of 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one?
The InChIKey is NYAOXAGBDJJTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3S2/c24-18(15-4-2-1-3-5-15)8-6-17-7-9-19(28-17)20(25)23-12-10-16(14-23)26-21-22-11-13-27-21/h1-5,7,9,11,13,16H,6,8,10,12,14H2.
What are the key properties of 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one?
1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one has a molecular weight of 412.54 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-[5-[3-(1,3-thiazol-2-yloxy)pyrrolidine-1-carbonyl]thiophen-2-yl]propan-1-one is sourced from PubChem (CID 163824238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).