C51H35N4+ — CID 163825368
12-[4-[4-(7,9-diaza-5-azoniatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)phenyl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole (PubChem CID 163825368) has the molecular formula C51H35N4+ and a molecular weight of 703.87 g/mol. Its IUPAC name is 12-[4-[4-(7,9-diaza-5-azoniatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)phenyl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole.
| Compound Name | 12-[4-[4-(7,9-diaza-5-azoniatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)phenyl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole |
|---|---|
| PubChem CID | 163825368 |
| Molecular Formula | C51H35N4+ |
| Molecular Weight | 703.87 g/mol |
| Exact Mass | 703.29 |
| IUPAC Name | 12-[4-[4-(7,9-diaza-5-azoniatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)phenyl]phenyl]-7,7-diphenylindeno[1,2-a]carbazole |
| SMILES | C1=Cc2c(n(-c3ccc(-c4ccc(-n5c6ccccc6c6ccc7c(c65)-c5ccccc5C7(c5ccccc5)c5ccccc5)cc4)cc3)c3[nH]ccc23)[NH2+]1 |
| InChI | InChI=1S/C51H34N4/c1-3-11-35(12-4-1)51(36-13-5-2-6-14-36)44-17-9-7-16-43(44)47-45(51)28-27-40-39-15-8-10-18-46(39)54(48(40)47)37-23-19-33(20-24-37)34-21-25-38(26-22-34)55-49-41(29-31-52-49)42-30-32-53-50(42)55/h1-32,52-53H/p+1 |
| InChIKey | NZACTEVKACJSRO-UHFFFAOYSA-O |
| XLogP | 11.27 |
| TPSA | 42.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.87 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |